ChemNet > CAS > 374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
| Nome do produto |
4-Bromo-3-fluorobenzeneboronic acid |
| Sinônimos |
4-Bromo-3-fluorophenylboronic acid |
| Fórmula molecular |
C6H5BBrFO2 |
| Peso Molecular |
218.8161 |
| InChI |
InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| CAS Registry Number |
374790-97-3 |
| Estrutura Molecular |
|
| Densidade |
1.75g/cm3 |
| Ponto de ebulição |
314.7°C at 760 mmHg |
| índice de refração |
1.571 |
| O ponto de inflamação |
144.1°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
